* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1687 |
English Synonyms: | RARECHEM AL BW 1687 |
MDL Number.: | MFCD06213429 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COCc1cc(nc(c1CN)O)[O-].C1CC[NH2+]CC1 |
InChi: | InChI=1S/C8H12N2O3.C5H11N/c1-13-4-5-2-7(11)10-8(12)6(5)3-9;1-2-4-6-5-3-1/h2H,3-4,9H2,1H3,(H2,10,11,12);6H,1-5H2 |
InChiKey: | InChIKey=WJQLVKINBLYFTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.