* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0220 |
English Synonyms: | RARECHEM AL BZ 0220 |
MDL Number.: | MFCD06216344 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCC/C=C/C=C/C(CC(=O)N)N |
InChi: | InChI=1S/C13H24N2O/c1-2-3-4-5-6-7-8-9-10-12(14)11-13(15)16/h7-10,12H,2-6,11,14H2,1H3,(H2,15,16)/b8-7+,10-9+ |
InChiKey: | InChIKey=XOFZFTUPQGXIND-XBLVEGMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.