* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0229 |
English Synonyms: | RARECHEM AL BZ 0229 |
MDL Number.: | MFCD06216353 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | COc1cc(cc(c1O)C(CC(=O)N)N)[N+](=O)[O-] |
InChi: | InChI=1S/C10H13N3O5/c1-18-8-3-5(13(16)17)2-6(10(8)15)7(11)4-9(12)14/h2-3,7,15H,4,11H2,1H3,(H2,12,14) |
InChiKey: | InChIKey=IXQIFAHPRCKZEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.