* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0373 |
English Synonyms: | RARECHEM AL BZ 0373 |
MDL Number.: | MFCD06216484 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C(C(C(=O)N)N)C(=O)N.O |
InChi: | InChI=1S/C4H9N3O2.H2O/c5-2(4(7)9)1-3(6)8;/h2H,1,5H2,(H2,6,8)(H2,7,9);1H2 |
InChiKey: | InChIKey=WXKTVBPWWYZTOQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.