* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0374 |
English Synonyms: | RARECHEM AL BZ 0374 |
MDL Number.: | MFCD06216485 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C(=O)C(CC(=O)N)N.O |
InChi: | InChI=1S/C10H12N2O2.H2O/c11-8(6-9(12)13)10(14)7-4-2-1-3-5-7;/h1-5,8H,6,11H2,(H2,12,13);1H2 |
InChiKey: | InChIKey=WOEVNKCNZNJNIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.