* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0382 |
English Synonyms: | RARECHEM AL BZ 0382 |
MDL Number.: | MFCD06216493 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1C(CC(=O)N)N)F |
InChi: | InChI=1S/C10H13FN2O2/c1-15-9-3-2-6(11)4-7(9)8(12)5-10(13)14/h2-4,8H,5,12H2,1H3,(H2,13,14) |
InChiKey: | InChIKey=VOFQTLSAYRKBQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.