* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1113 |
English Synonyms: | RARECHEM AL BZ 1113 |
MDL Number.: | MFCD06217124 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cncnc1/C(=C\O)/C(CC(=O)N)N |
InChi: | InChI=1S/C9H12N4O2/c10-7(3-9(11)15)6(4-14)8-1-2-12-5-13-8/h1-2,4-5,7,14H,3,10H2,(H2,11,15)/b6-4- |
InChiKey: | InChIKey=WEUPHZUWQIHJTR-XQRVVYSFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.