* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1122 |
English Synonyms: | RARECHEM AL BZ 1122 |
MDL Number.: | MFCD06217133 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | COc1ccc(cc1)/C(=C/O)/C(CC(=O)N)N |
InChi: | InChI=1S/C12H16N2O3/c1-17-9-4-2-8(3-5-9)10(7-15)11(13)6-12(14)16/h2-5,7,11,15H,6,13H2,1H3,(H2,14,16)/b10-7- |
InChiKey: | InChIKey=SHKXKZMXJNBKCZ-YFHOEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.