* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1130 |
English Synonyms: | RARECHEM AL BZ 1130 |
MDL Number.: | MFCD06217140 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)(C)S(=O)(=O)/C(=C/c1c(ccs1)C(CC(=O)N)N)/C#N |
InChi: | InChI=1S/C14H19N3O3S2/c1-14(2,3)22(19,20)9(8-15)6-12-10(4-5-21-12)11(16)7-13(17)18/h4-6,11H,7,16H2,1-3H3,(H2,17,18)/b9-6+ |
InChiKey: | InChIKey=PYVVOXLBYCTAMS-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.