* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1138 |
English Synonyms: | RARECHEM AL BZ 1138 |
MDL Number.: | MFCD06217148 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCCCc1[nH]cc(n1)C(CC(=O)N)N |
InChi: | InChI=1S/C10H18N4O/c1-2-3-4-10-13-6-8(14-10)7(11)5-9(12)15/h6-7H,2-5,11H2,1H3,(H2,12,15)(H,13,14) |
InChiKey: | InChIKey=CEIKERZUJKNTSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.