* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1252 |
English Synonyms: | RARECHEM AL BZ 1252 |
MDL Number.: | MFCD06217258 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)c2ccc(cc2)C(CC(=O)N)N |
InChi: | InChI=1S/C16H18N2O/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)15(17)10-16(18)19/h2-9,15H,10,17H2,1H3,(H2,18,19) |
InChiKey: | InChIKey=PEIHCMBPDNEEDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.