* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1266 |
English Synonyms: | RARECHEM AL BZ 1266 |
MDL Number.: | MFCD06217271 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)S(=O)(=O)n2c3ccccc3cc2C(CC(=O)N)N |
InChi: | InChI=1S/C17H17N3O3S/c18-14(11-17(19)21)16-10-12-6-4-5-9-15(12)20(16)24(22,23)13-7-2-1-3-8-13/h1-10,14H,11,18H2,(H2,19,21) |
InChiKey: | InChIKey=PXXLMADALFJPBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.