* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8019 |
English Synonyms: | RARECHEM AQ BC 8019 |
MDL Number.: | MFCD06227550 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COC(=O)[C@@H]1[C@H]2C[C@@H]([C@@H]([C@H]2C[C@@H]1Cl)C(=O)OC)Cl |
InChi: | InChI=1S/C12H16Cl2O4/c1-17-11(15)9-5-3-8(14)10(12(16)18-2)6(5)4-7(9)13/h5-10H,3-4H2,1-2H3/t5-,6-,7-,8-,9+,10+/m0/s1 |
InChiKey: | InChIKey=FBVJLOOAQKXQHK-KZZCMQFTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.