* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8071 |
English Synonyms: | RARECHEM AQ BC 8071 |
MDL Number.: | MFCD06227556 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@@]12CCC[C@@]1([C@@](C[C@H]2C#N)(C#N)O[Si](C)(C)C)C |
InChi: | InChI=1S/C15H24N2OSi/c1-13-7-6-8-14(13,2)15(11-17,9-12(13)10-16)18-19(3,4)5/h12H,6-9H2,1-5H3/t12-,13-,14-,15+/m0/s1 |
InChiKey: | InChIKey=YDDPMKKRMBAENQ-ZQDZILKHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.