* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8074 |
English Synonyms: | RARECHEM AQ BC 8074 |
MDL Number.: | MFCD06227558 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@]12CC[C@]([C@]1(CCC2=O)C)(C#Cc3ccccc3)O |
InChi: | InChI=1S/C18H20O2/c1-16-12-13-18(20,17(16,2)10-9-15(16)19)11-8-14-6-4-3-5-7-14/h3-7,20H,9-10,12-13H2,1-2H3/t16-,17+,18+/m1/s1 |
InChiKey: | InChIKey=GUIXAPOOTIQQDI-SQNIBIBYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.