* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8110 |
English Synonyms: | RARECHEM AQ BC 8110 |
MDL Number.: | MFCD06227571 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C[C@]12[C@@H](CC([C@]1([C@@H](CC2(C#N)O[Si](C)(C)C)c3ccccc3)C)(C#N)O[Si](C)(C)C)c4ccccc4 |
InChi: | InChI=1S/C30H40N2O2Si2/c1-27-25(23-15-11-9-12-16-23)19-30(22-32,34-36(6,7)8)28(27,2)26(24-17-13-10-14-18-24)20-29(27,21-31)33-35(3,4)5/h9-18,25-26H,19-20H2,1-8H3/t25-,26-,27-,28-,29?,30?/m0/s1 |
InChiKey: | InChIKey=LRHBAWMZMYGFDN-XZENETLCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.