* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SCOPOLINE |
| CAS: | 487-27-4 |
| English Synonyms: | SCOPOLINE |
| MDL Number.: | MFCD07783424 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CN1[C@H]2C[C@H]3C[C@@H]1[C@@H]([C@H]2O)O3 |
| InChi: | InChI=1S/C8H13NO2/c1-9-5-2-4-3-6(9)8(11-4)7(5)10/h4-8,10H,2-3H2,1H3/t4-,5-,6+,7-,8-/m0/s1 |
| InChiKey: | InChIKey=MEGPURSNXMUDAE-RLMOJYMMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.