* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,2,3,4-TETRAHYDROPYRIDO[2,3-B]PYRAZINE |
CAS: | 35808-40-3 |
English Synonyms: | 1,2,3,4-TETRAHYDROPYRIDO[2,3-B]PYRAZINE ; PYRIDO[2,3-B]PYRAZINE, 1,2,3,4-TETRAHYDRO- ; 1H,2H,3H,4H-PYRIDO[2,3-B]PYRAZINE |
MDL Number.: | MFCD08062758 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc2c(nc1)NCCN2 |
InChi: | InChI=1S/C7H9N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-3,8H,4-5H2,(H,9,10) |
InChiKey: | InChIKey=HOFCYSNYAFJTSI-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.