* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GYMNODIMINE |
CAS: | 173792-58-0 |
English Synonyms: | CRM-GYM ; GYMNODIMINE |
MDL Number.: | MFCD08435951 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C[C@@H]1C[C@H]2CC[C@@H](/C(=C/[C@H]3C(=C(CC[C@@]34CCCN=C4CC/C=C(/[C@@H]1O2)\C)[C@@H]5C=C(C(=O)O5)C)C)/C)O |
InChi: | InChI=1S/C32H45NO4/c1-19-8-6-9-29-32(13-7-15-33-29)14-12-25(28-18-22(4)31(35)37-28)23(5)26(32)17-20(2)27(34)11-10-24-16-21(3)30(19)36-24/h8,17-18,21,24,26-28,30,34H,6-7,9-16H2,1-5H3/b19-8+,20-17+/t21-,24-,26+,27+,28+,30+,32+/m1/s1 |
InChiKey: | InChIKey=DVXZVCNEGRKLMW-RPGUUIFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.