* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 1016 |
| EnglishSynonyms: | RARECHEM AX KI 1016 |
| pro_mdlNumber: | MFCD08456664 |
| pro_acceptors: | 6 |
| pro_donors: | 3 |
| pro_smile: | Cn1c2ccccc2cc1C(CC(=O)NC(CC(=O)O)c3ccsc3)N |
| InChi: | InChI=1S/C19H21N3O3S/c1-22-16-5-3-2-4-12(16)8-17(22)14(20)9-18(23)21-15(10-19(24)25)13-6-7-26-11-13/h2-8,11,14-15H,9-10,20H2,1H3,(H,21,23)(H,24,25) |
| InChiKey: | InChIKey=RRKSQKNKEIJXJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.