* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRENOCINE B |
| CAS: | 72674-29-4 |
| English Synonyms: | PYRENOCINE B |
| MDL Number.: | MFCD09752754 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1c(c(cc(=O)o1)OC)C(=O)CC(C)O |
| InChi: | InChI=1S/C11H14O5/c1-6(12)4-8(13)11-7(2)16-10(14)5-9(11)15-3/h5-6,12H,4H2,1-3H3 |
| InChiKey: | InChIKey=NXDGLHJHHJJTSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.