* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WAY 170523 |
CAS: | 307002-73-9 |
English Synonyms: | WAY 170523 |
MDL Number.: | MFCD09753279 |
H bond acceptor: | 10 |
H bond donor: | 3 |
Smile: | Cc1cc(c(c(c1)C(=O)NO)N(Cc2ccccc2)S(=O)(=O)c3ccc(cc3)OCCNC(=O)c4cc5ccccc5o4)C |
InChi: | InChI=1S/C33H31N3O7S/c1-22-18-23(2)31(28(19-22)32(37)35-39)36(21-24-8-4-3-5-9-24)44(40,41)27-14-12-26(13-15-27)42-17-16-34-33(38)30-20-25-10-6-7-11-29(25)43-30/h3-15,18-20,39H,16-17,21H2,1-2H3,(H,34,38)(H,35,37) |
InChiKey: | InChIKey=FARMEEAGJWMFSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.