* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHRYSCANDIN |
| CAS: | 86936-90-5 |
| English Synonyms: | CHRYSCANDIN |
| MDL Number.: | MFCD09838094 |
| H bond acceptor: | 13 |
| H bond donor: | 5 |
| Smile: | COc1ccc(cc1)C[C@@H](C(=O)N[C@H]2[C@H]([C@@H](O[C@@H]2C(=O)O)n3cnc4c3ncnc4N)O)N |
| InChi: | InChI=1S/C20H23N7O6/c1-32-10-4-2-9(3-5-10)6-11(21)18(29)26-12-14(28)19(33-15(12)20(30)31)27-8-25-13-16(22)23-7-24-17(13)27/h2-5,7-8,11-12,14-15,19,28H,6,21H2,1H3,(H,26,29)(H,30,31)(H2,22,23,24)/t11-,12-,14+,15-,19+/m0/s1 |
| InChiKey: | InChIKey=TXYMIIPGRTXESZ-JDZCFQESSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.