* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(3,4-DICHLORO-PHENYL)-3,4,5,6,7,9-HEXAHYDRO-2H-XANTHENE-1,8-DIONE |
English Synonyms: | 9-(3,4-DICHLORO-PHENYL)-3,4,5,6,7,9-HEXAHYDRO-2H-XANTHENE-1,8-DIONE |
MDL Number.: | MFCD10567599 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1C2C3=C(CCCC3=O)OC4=C2C(=O)CCC4)Cl)Cl |
InChi: | InChI=1S/C19H16Cl2O3/c20-11-8-7-10(9-12(11)21)17-18-13(22)3-1-5-15(18)24-16-6-2-4-14(23)19(16)17/h7-9,17H,1-6H2 |
InChiKey: | InChIKey=XEGIHXBUQKLJQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.