* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(1H-INDOL-3-YL)-2-PENTANONE |
CAS: | 77606-05-4 |
English Synonyms: | 5-(1H-INDOL-3-YL)-2-PENTANONE ; 5-(1H-INDOL-3-YL)PENTAN-2-ONE |
MDL Number.: | MFCD11040298 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(=O)CCCc1c[nH]c2c1cccc2 |
InChi: | InChI=1S/C13H15NO/c1-10(15)5-4-6-11-9-14-13-8-3-2-7-12(11)13/h2-3,7-9,14H,4-6H2,1H3 |
InChiKey: | InChIKey=VBBLNFBPZYQBNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.