* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIMETHYL-3,5,6-TRIAZATRICYCLO[8.4.0.0(2,7)]TETRADECA-1(10),2(7),3,5,11,13-HEXAEN-4-AMINE |
English Synonyms: | 9,9-DIMETHYL-3,5,6-TRIAZATRICYCLO[8.4.0.0(2,7)]TETRADECA-1(10),2(7),3,5,11,13-HEXAEN-4-AMINE |
MDL Number.: | MFCD11134117 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC=2N=NC(=NC2C=2C=CC=CC12)N)C |
InChi: | InChI=1S/C13H14N4/c1-13(2)7-10-11(15-12(14)17-16-10)8-5-3-4-6-9(8)13/h3-6H,7H2,1-2H3,(H2,14,15,17) |
InChiKey: | InChIKey=ZXFNPQAFKPAPFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.