* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-6-ETHOXYANILINE |
CAS: | 1072945-59-5 |
English Synonyms: | 2-BROMO-6-ETHOXYANILINE |
MDL Number.: | MFCD11504835 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCOc1cccc(c1N)Br |
InChi: | InChI=1S/C8H10BrNO/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2,10H2,1H3 |
InChiKey: | InChIKey=BMRDKLUDXJPIFQ-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.