* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DIMETHYLDEC-1-ENE |
| CAS: | 55170-80-4 |
| English Synonyms: | 2,4-DIMETHYL-1-DECENE ; 2,4-DIMETHYLDEC-1-ENE |
| MDL Number.: | MFCD11554093 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCCCC(C)CC(=C)C |
| InChi: | InChI=1S/C12H24/c1-5-6-7-8-9-12(4)10-11(2)3/h12H,2,5-10H2,1,3-4H3 |
| InChiKey: | InChIKey=DCJZDSLNTFHRSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.