* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ETHYL-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
English Synonyms: | 9-ETHYL-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
MDL Number.: | MFCD11651594 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCc1cccc2c1OCCCC2N |
InChi: | InChI=1S/C12H17NO/c1-2-9-5-3-6-10-11(13)7-4-8-14-12(9)10/h3,5-6,11H,2,4,7-8,13H2,1H3 |
InChiKey: | InChIKey=FASXPPNIRNZHOM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.