* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEPT-6-YN-3-ONE |
| English Synonyms: | HEPT-6-YN-3-ONE |
| MDL Number.: | MFCD11655284 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCC(=O)CCC#C |
| InChi: | InChI=1S/C7H10O/c1-3-5-6-7(8)4-2/h1H,4-6H2,2H3 |
| InChiKey: | InChIKey=IPYXVZSAIISGFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.