* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-6-FLUORO-1H-INDOLE |
| CAS: | 434960-42-6 ;105391-70-6 |
| English Synonyms: | 5-BROMO-6-FLUORO-1H-INDOLE ; 5-BROMO-6-FLUOROINDOLE |
| MDL Number.: | MFCD11848565 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1c[nH]c2c1cc(c(c2)F)Br |
| InChi: | InChI=1S/C8H5BrFN/c9-6-3-5-1-2-11-8(5)4-7(6)10/h1-4,11H |
| InChiKey: | InChIKey=HAKIMTKXOCVWRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.