* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-AMINO-1-(PYRIDIN-3-YL)BUTAN-1-ONE |
CAS: | 71278-11-0 |
English Synonyms: | 4-AMINO-1-(PYRIDIN-3-YL)BUTAN-1-ONE |
MDL Number.: | MFCD11858515 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)C(=O)CCCN |
InChi: | InChI=1S/C9H12N2O/c10-5-1-4-9(12)8-3-2-6-11-7-8/h2-3,6-7H,1,4-5,10H2 |
InChiKey: | InChIKey=HFMNHVQBLYDLAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.