* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-((2R)-2-PIPERIDYL)-5,6,7,8-TETRAHYDROACRIDINE |
English Synonyms: | 9-((2R)-2-PIPERIDYL)-5,6,7,8-TETRAHYDROACRIDINE |
MDL Number.: | MFCD11864630 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c3c(n2)CCCC3)[C@H]4CCCCN4 |
InChi: | InChI=1S/C18H22N2/c1-3-9-15-13(7-1)18(17-11-5-6-12-19-17)14-8-2-4-10-16(14)20-15/h1,3,7,9,17,19H,2,4-6,8,10-12H2/t17-/m1/s1 |
InChiKey: | InChIKey=IDDXIAVXTPFDCZ-QGZVFWFLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.