* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GENDENAFIL |
CAS: | 147676-66-2 |
English Synonyms: | GENDENAFIL |
MDL Number.: | MFCD11977918 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCCc1c2c(c(=O)[nH]c(n2)c3cc(ccc3OCC)C(=O)C)n(n1)C |
InChi: | InChI=1S/C19H22N4O3/c1-5-7-14-16-17(23(4)22-14)19(25)21-18(20-16)13-10-12(11(3)24)8-9-15(13)26-6-2/h8-10H,5-7H2,1-4H3,(H,20,21,25) |
InChiKey: | InChIKey=YJBDHZKAVGNHET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.