* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DORASTINE HCL |
| CAS: | 21228-28-4 ;21228-13-7 |
| English Synonyms: | DORASTINE HCL |
| MDL Number.: | MFCD12032152 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cn1)CCn2c3ccc(cc3c4c2CCN(C4)C)Cl.Cl.Cl |
| InChi: | InChI=1S/C20H22ClN3.2ClH/c1-14-3-4-15(12-22-14)7-10-24-19-6-5-16(21)11-17(19)18-13-23(2)9-8-20(18)24;;/h3-6,11-12H,7-10,13H2,1-2H3;2*1H |
| InChiKey: | InChIKey=XGGILFZLGXIRFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.