* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TIMTEC-BB SBB045799 |
| English Synonyms: | TIMTEC-BB SBB045799 |
| MDL Number.: | MFCD12548323 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)C)OCC(Cn2c3ccccc3nc2C4CC4)O |
| InChi: | InChI=1S/C21H24N2O2/c1-14-7-10-20(15(2)11-14)25-13-17(24)12-23-19-6-4-3-5-18(19)22-21(23)16-8-9-16/h3-7,10-11,16-17,24H,8-9,12-13H2,1-2H3 |
| InChiKey: | InChIKey=OLJJPTPADNOTJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.