* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-AMINO-2-(6-BROMO-1H-1,3-BENZODIAZOL-2-YL)PHENOL |
English Synonyms: | 5-AMINO-2-(6-BROMO-1H-1,3-BENZODIAZOL-2-YL)PHENOL |
MDL Number.: | MFCD12720940 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1N)O)c2[nH]c3cc(ccc3n2)Br |
InChi: | InChI=1S/C13H10BrN3O/c14-7-1-4-10-11(5-7)17-13(16-10)9-3-2-8(15)6-12(9)18/h1-6,18H,15H2,(H,16,17) |
InChiKey: | InChIKey=KYKPJRZWRKDBHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.