* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC274038 |
English Synonyms: | BCH-RESEARCH BC274038 |
MDL Number.: | MFCD12727228 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCn1cc(c(n1)N)S(=O)(=O)NCC(C)O |
InChi: | InChI=1S/C9H18N4O3S/c1-3-4-13-6-8(9(10)12-13)17(15,16)11-5-7(2)14/h6-7,11,14H,3-5H2,1-2H3,(H2,10,12) |
InChiKey: | InChIKey=NTDVFOKGNXNUQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.