* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC279263 |
English Synonyms: | BCH-RESEARCH BC279263 |
MDL Number.: | MFCD12731100 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CCC(C)N(CC(=O)O)C(=O)c1c[nH]c(=O)[nH]c1=O |
InChi: | InChI=1S/C11H15N3O5/c1-3-6(2)14(5-8(15)16)10(18)7-4-12-11(19)13-9(7)17/h4,6H,3,5H2,1-2H3,(H,15,16)(H2,12,13,17,19) |
InChiKey: | InChIKey=FJEJKMGGDGUXPR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.