* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CYCLOHEXYL-4H-1,2,4-TRIAZOLE |
| CAS: | 29982-72-7 |
| English Synonyms: | 4-CYCLOHEXYL-4H-1,2,4-TRIAZOLE ; 4H-1,2,4-TRIAZOLE, 4-CYCLOHEXYL- |
| MDL Number.: | MFCD14707680 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1nncn1C2CCCCC2 |
| InChi: | InChI=1S/C8H13N3/c1-2-4-8(5-3-1)11-6-9-10-7-11/h6-8H,1-5H2 |
| InChiKey: | InChIKey=WIBOSJZEMIENSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.