* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 8-HYDROXYADENOSINE |
CAS: | 29851-57-8 |
English Synonyms: | 8-HYDROXYADENOSINE |
MDL Number.: | MFCD15145291 |
H bond acceptor: | 10 |
H bond donor: | 5 |
Smile: | c1nc(c2c(n1)n(c(n2)O)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
InChi: | InChI=1S/C10H13N5O5/c11-7-4-8(13-2-12-7)15(10(19)14-4)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,14,19)(H2,11,12,13)/t3-,5-,6-,9-/m1/s1 |
InChiKey: | InChIKey=UEHOMUNTZPIBIL-UUOKFMHZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.