* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-1,2,4,5,9-PENTAAZASPIRO[5.5]UNDECANE-3-THIONE |
English Synonyms: | 9-METHYL-1,2,4,5,9-PENTAAZASPIRO[5.5]UNDECANE-3-THIONE |
MDL Number.: | MFCD15203677 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | CN1CCC2(CC1)NNC(=S)NN2 |
InChi: | InChI=1S/C7H15N5S/c1-12-4-2-7(3-5-12)10-8-6(13)9-11-7/h10-11H,2-5H2,1H3,(H2,8,9,13) |
InChiKey: | InChIKey=KFRKBNSPBMHVNB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.