* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPAN-2-YL 2-[2-(4-METHYL-1,3-THIAZOL-5-YL)ETHOXY]ACETATE |
English Synonyms: | PROPAN-2-YL 2-[2-(4-METHYL-1,3-THIAZOL-5-YL)ETHOXY]ACETATE |
MDL Number.: | MFCD16073189 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1c(scn1)CCOCC(=O)OC(C)C |
InChi: | InChI=1S/C11H17NO3S/c1-8(2)15-11(13)6-14-5-4-10-9(3)12-7-16-10/h7-8H,4-6H2,1-3H3 |
InChiKey: | InChIKey=DQGGUNOAFIEUHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.