* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-[2-(METHYLAMINO)ETHYL]-9H-PURIN-6-AMINE |
English Synonyms: | 9-[2-(METHYLAMINO)ETHYL]-9H-PURIN-6-AMINE |
MDL Number.: | MFCD16074155 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CNCCn1cnc2c1ncnc2N |
InChi: | InChI=1S/C8H12N6/c1-10-2-3-14-5-13-6-7(9)11-4-12-8(6)14/h4-5,10H,2-3H2,1H3,(H2,9,11,12) |
InChiKey: | InChIKey=GPFJQMOPYARYDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.