* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(ETHYL[(1-PROPYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINO)ETHAN-1-OL |
| English Synonyms: | 2-(ETHYL[(1-PROPYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINO)ETHAN-1-OL |
| MDL Number.: | MFCD16152533 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCCn1c(nnn1)CN(CC)CCO |
| InChi: | InChI=1S/C9H19N5O/c1-3-5-14-9(10-11-12-14)8-13(4-2)6-7-15/h15H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=JXIQWZAKPVFRIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.