* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[(3-CHLOROPROP-2-EN-1-YL)(METHYL)AMINO]ETHAN-1-OL |
English Synonyms: | 2-[(3-CHLOROPROP-2-EN-1-YL)(METHYL)AMINO]ETHAN-1-OL |
MDL Number.: | MFCD16153140 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN(CCO)C/C=C/Cl |
InChi: | InChI=1S/C6H12ClNO/c1-8(5-6-9)4-2-3-7/h2-3,9H,4-6H2,1H3/b3-2+ |
InChiKey: | InChIKey=DVIPNBYFNYXYIH-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.