* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-FLUORO-N-(1H-1,2,3,4-TETRAZOL-5-YLMETHYL)BENZAMIDE |
| English Synonyms: | 2-FLUORO-N-(1H-1,2,3,4-TETRAZOL-5-YLMETHYL)BENZAMIDE |
| MDL Number.: | MFCD16155637 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)C(=O)NCc2[nH]nnn2)F |
| InChi: | InChI=1S/C9H8FN5O/c10-7-4-2-1-3-6(7)9(16)11-5-8-12-14-15-13-8/h1-4H,5H2,(H,11,16)(H,12,13,14,15) |
| InChiKey: | InChIKey=CVNMFFOJSAJRQK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.