* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1815119 |
| English Synonyms: | OTAVA-BB 1815119 |
| MDL Number.: | MFCD16327174 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COC1=C(OC)C=C(NCCN2CCCC2)C=C1 |
| InChi: | InChI=1S/C14H22N2O2/c1-17-13-6-5-12(11-14(13)18-2)15-7-10-16-8-3-4-9-16/h5-6,11,15H,3-4,7-10H2,1-2H3 |
| InChiKey: | InChIKey=HXTXZBRJXUFYIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.