* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1818609 |
English Synonyms: | OTAVA-BB 1818609 |
MDL Number.: | MFCD16330034 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)(C)C1=CC=C(C=C1)C(C#N)C1CCCCC1 |
InChi: | InChI=1S/C18H25N/c1-18(2,3)16-11-9-15(10-12-16)17(13-19)14-7-5-4-6-8-14/h9-12,14,17H,4-8H2,1-3H3 |
InChiKey: | InChIKey=JOUHOENDKQGPPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.