* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1818638 |
English Synonyms: | OTAVA-BB 1818638 |
MDL Number.: | MFCD16330061 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCCC(=O)NC(C(O)=O)C1=CC(Cl)=CC=C1 |
InChi: | InChI=1S/C12H14ClNO3/c1-2-4-10(15)14-11(12(16)17)8-5-3-6-9(13)7-8/h3,5-7,11H,2,4H2,1H3,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=PIPUREQKEUKHEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.